C10H14ClF4NO4 — CID 134863080
methyl 3-chloro-3,4,4,4-tetrafluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 134863080) has the molecular formula C10H14ClF4NO4 and a molecular weight of 323.67 g/mol. Its IUPAC name is methyl 3-chloro-3,4,4,4-tetrafluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl 3-chloro-3,4,4,4-tetrafluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 134863080 |
| Molecular Formula | C10H14ClF4NO4 |
| Molecular Weight | 323.67 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | methyl 3-chloro-3,4,4,4-tetrafluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COC(=O)C(NC(=O)OC(C)(C)C)C(F)(Cl)C(F)(F)F |
| InChI | InChI=1S/C10H14ClF4NO4/c1-8(2,3)20-7(18)16-5(6(17)19-4)9(11,12)10(13,14)15/h5H,1-4H3,(H,16,18) |
| InChIKey | LHLVQAWXEQSWHU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.67 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|