C14H22F3NO4 — CID 5461791
methyl (Z,2R,5S)-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethyl)hex-3-enoate (PubChem CID 5461791) has the molecular formula C14H22F3NO4 and a molecular weight of 325.33 g/mol. Its IUPAC name is methyl (Z,2R,5S)-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethyl)hex-3-enoate.
| Compound Name | methyl (Z,2R,5S)-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethyl)hex-3-enoate |
|---|---|
| PubChem CID | 5461791 |
| Molecular Formula | C14H22F3NO4 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | methyl (Z,2R,5S)-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(trifluoromethyl)hex-3-enoate |
| SMILES | COC(=O)[C@H](C)/C=C(/[C@H](C)NC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H22F3NO4/c1-8(11(19)21-6)7-10(14(15,16)17)9(2)18-12(20)22-13(3,4)5/h7-9H,1-6H3,(H,18,20)/b10-7-/t8-,9+/m1/s1 |
| InChIKey | CBROOKWMFVFAAQ-GYDIXIQSSA-N |
| XLogP | 3.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|