C12H20FNO4 — CID 87772629
4-fluoro-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-3-enoic acid (PubChem CID 87772629) has the molecular formula C12H20FNO4 and a molecular weight of 261.29 g/mol. Its IUPAC name is 4-fluoro-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-3-enoic acid.
| Compound Name | 4-fluoro-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-3-enoic acid |
|---|---|
| PubChem CID | 87772629 |
| Molecular Formula | C12H20FNO4 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 4-fluoro-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]hex-3-enoic acid |
| SMILES | CC(C=C(F)C(C)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H20FNO4/c1-7(10(15)16)6-9(13)8(2)14-11(17)18-12(3,4)5/h6-8H,1-5H3,(H,14,17)(H,15,16) |
| InChIKey | IQFGCWLRLFCETO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |