C11H21FN2O3 — CID 21309305
tert-butyl N-[(2R)-3-fluoro-3-methyl-1-(methylamino)-1-oxobutan-2-yl]carbamate (PubChem CID 21309305) has the molecular formula C11H21FN2O3 and a molecular weight of 248.30 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-fluoro-3-methyl-1-(methylamino)-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-fluoro-3-methyl-1-(methylamino)-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 21309305 |
| Molecular Formula | C11H21FN2O3 |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | tert-butyl N-[(2R)-3-fluoro-3-methyl-1-(methylamino)-1-oxobutan-2-yl]carbamate |
| SMILES | CNC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)F |
| InChI | InChI=1S/C11H21FN2O3/c1-10(2,3)17-9(16)14-7(8(15)13-6)11(4,5)12/h7H,1-6H3,(H,13,15)(H,14,16)/t7-/m1/s1 |
| InChIKey | FBVVMZSFDXRABB-SSDOTTSWSA-N |
| XLogP | 1.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |