C11H22ClN3O3 — CID 59806972
tert-butyl N-[(2R)-5-(chloroamino)-1-(methylamino)-1-oxopentan-2-yl]carbamate (PubChem CID 59806972) has the molecular formula C11H22ClN3O3 and a molecular weight of 279.77 g/mol. Its IUPAC name is tert-butyl N-[(2R)-5-(chloroamino)-1-(methylamino)-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-5-(chloroamino)-1-(methylamino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 59806972 |
| Molecular Formula | C11H22ClN3O3 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | tert-butyl N-[(2R)-5-(chloroamino)-1-(methylamino)-1-oxopentan-2-yl]carbamate |
| SMILES | CNC(=O)[C@@H](CCCNCl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22ClN3O3/c1-11(2,3)18-10(17)15-8(9(16)13-4)6-5-7-14-12/h8,14H,5-7H2,1-4H3,(H,13,16)(H,15,17)/t8-/m1/s1 |
| InChIKey | ZRQARFCBVXINCK-MRVPVSSYSA-N |
| XLogP | 1.15 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|