C17H32N2O4 — CID 175536770
tert-butyl N-[5-(4-hydroxycyclohexyl)-1-(methylamino)-1-oxopentan-2-yl]carbamate (PubChem CID 175536770) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is tert-butyl N-[5-(4-hydroxycyclohexyl)-1-(methylamino)-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-(4-hydroxycyclohexyl)-1-(methylamino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 175536770 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | tert-butyl N-[5-(4-hydroxycyclohexyl)-1-(methylamino)-1-oxopentan-2-yl]carbamate |
| SMILES | CNC(=O)C(CCCC1CCC(O)CC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H32N2O4/c1-17(2,3)23-16(22)19-14(15(21)18-4)7-5-6-12-8-10-13(20)11-9-12/h12-14,20H,5-11H2,1-4H3,(H,18,21)(H,19,22) |
| InChIKey | BJSNIUPNZDPGPS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |