C11H22INO3 — CID 87726897
tert-butyl N-[(2S)-1-hydroxy-1-iodo-3,3-dimethylbutan-2-yl]carbamate (PubChem CID 87726897) has the molecular formula C11H22INO3 and a molecular weight of 343.21 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-hydroxy-1-iodo-3,3-dimethylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-hydroxy-1-iodo-3,3-dimethylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 87726897 |
| Molecular Formula | C11H22INO3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | tert-butyl N-[(2S)-1-hydroxy-1-iodo-3,3-dimethylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(O)I)C(C)(C)C |
| InChI | InChI=1S/C11H22INO3/c1-10(2,3)7(8(12)14)13-9(15)16-11(4,5)6/h7-8,14H,1-6H3,(H,13,15)/t7-,8?/m1/s1 |
| InChIKey | KEUZYSAAABVHGP-GVHYBUMESA-N |
| XLogP | 2.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|