C6H11Cl3NO5P — CID 7024921
methyl N-[(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethyl]carbamate (PubChem CID 7024921) has the molecular formula C6H11Cl3NO5P and a molecular weight of 314.49 g/mol. Its IUPAC name is methyl N-[(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethyl]carbamate.
| Compound Name | methyl N-[(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethyl]carbamate |
|---|---|
| PubChem CID | 7024921 |
| Molecular Formula | C6H11Cl3NO5P |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 312.94 |
| IUPAC Name | methyl N-[(1R)-2,2,2-trichloro-1-dimethoxyphosphorylethyl]carbamate |
| SMILES | COC(=O)N[C@@H](C(Cl)(Cl)Cl)P(=O)(OC)OC |
| InChI | InChI=1S/C6H11Cl3NO5P/c1-13-5(11)10-4(6(7,8)9)16(12,14-2)15-3/h4H,1-3H3,(H,10,11)/t4-/m1/s1 |
| InChIKey | YJJCWNFJTXDBRN-SCSAIBSYSA-N |
| XLogP | 2.52 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|