About 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide
3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide (PubChem CID 3461916) has the molecular formula C11H21Cl3NO4P
and a molecular weight of 368.63 g/mol. Its IUPAC name is 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide.
Molecular Properties
| Compound Name | 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide |
| PubChem CID | 3461916 |
| Molecular Formula | C11H21Cl3NO4P |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide |
| SMILES | CCOP(=O)(OCC)C(NC(=O)CC(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H21Cl3NO4P/c1-5-18-20(17,19-6-2)10(11(12,13)14)15-9(16)7-8(3)4/h8,10H,5-7H2,1-4H3,(H,15,16) |
| InChIKey | IGTTWYCPRMGAID-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide?
The IUPAC name of 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide (CID 3461916) is 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide.
What is the SMILES notation for 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide?
The canonical SMILES for 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide is CCOP(=O)(OCC)C(NC(=O)CC(C)C)C(Cl)(Cl)Cl.
What is the InChIKey of 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide?
The InChIKey is IGTTWYCPRMGAID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21Cl3NO4P/c1-5-18-20(17,19-6-2)10(11(12,13)14)15-9(16)7-8(3)4/h8,10H,5-7H2,1-4H3,(H,15,16).
What are the key properties of 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide?
3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide has a molecular weight of 368.63 g/mol, XLogP of 4.11, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-(2,2,2-trichloro-1-diethoxyphosphorylethyl)butanamide is sourced from PubChem (CID 3461916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).