C11H24O8P2 — CID 19689030
3,3-bis(diethoxyphosphoryl)propanoic acid (PubChem CID 19689030) has the molecular formula C11H24O8P2 and a molecular weight of 346.25 g/mol. Its IUPAC name is 3,3-bis(diethoxyphosphoryl)propanoic acid.
| Compound Name | 3,3-bis(diethoxyphosphoryl)propanoic acid |
|---|---|
| PubChem CID | 19689030 |
| Molecular Formula | C11H24O8P2 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 3,3-bis(diethoxyphosphoryl)propanoic acid |
| SMILES | CCOP(=O)(OCC)C(CC(=O)O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C11H24O8P2/c1-5-16-20(14,17-6-2)11(9-10(12)13)21(15,18-7-3)19-8-4/h11H,5-9H2,1-4H3,(H,12,13) |
| InChIKey | GDQZCDGSLKIQJU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|