C15H33NO7P2 — CID 19689044
N-butyl-3,3-bis(diethoxyphosphoryl)propanamide (PubChem CID 19689044) has the molecular formula C15H33NO7P2 and a molecular weight of 401.38 g/mol. Its IUPAC name is N-butyl-3,3-bis(diethoxyphosphoryl)propanamide.
| Compound Name | N-butyl-3,3-bis(diethoxyphosphoryl)propanamide |
|---|---|
| PubChem CID | 19689044 |
| Molecular Formula | C15H33NO7P2 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-butyl-3,3-bis(diethoxyphosphoryl)propanamide |
| SMILES | CCCCNC(=O)CC(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H33NO7P2/c1-6-11-12-16-14(17)13-15(24(18,20-7-2)21-8-3)25(19,22-9-4)23-10-5/h15H,6-13H2,1-5H3,(H,16,17) |
| InChIKey | YODFDAJIZMDVCS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|