C9H19NO3 — CID 138705714
N-butyl-3,3-dimethoxypropanamide (PubChem CID 138705714) has the molecular formula C9H19NO3 and a molecular weight of 189.25 g/mol. Its IUPAC name is N-butyl-3,3-dimethoxypropanamide.
| Compound Name | N-butyl-3,3-dimethoxypropanamide |
|---|---|
| PubChem CID | 138705714 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | N-butyl-3,3-dimethoxypropanamide |
| SMILES | CCCCNC(=O)CC(OC)OC |
| InChI | InChI=1S/C9H19NO3/c1-4-5-6-10-8(11)7-9(12-2)13-3/h9H,4-7H2,1-3H3,(H,10,11) |
| InChIKey | AVWQNNHBCFWBMZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|