C13H26O10P2 — CID 23283927
2-[2,2-bis(diethoxyphosphoryl)ethyl]propanedioic acid (PubChem CID 23283927) has the molecular formula C13H26O10P2 and a molecular weight of 404.29 g/mol. Its IUPAC name is 2-[2,2-bis(diethoxyphosphoryl)ethyl]propanedioic acid.
| Compound Name | 2-[2,2-bis(diethoxyphosphoryl)ethyl]propanedioic acid |
|---|---|
| PubChem CID | 23283927 |
| Molecular Formula | C13H26O10P2 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-[2,2-bis(diethoxyphosphoryl)ethyl]propanedioic acid |
| SMILES | CCOP(=O)(OCC)C(CC(C(=O)O)C(=O)O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H26O10P2/c1-5-20-24(18,21-6-2)11(9-10(12(14)15)13(16)17)25(19,22-7-3)23-8-4/h10-11H,5-9H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | ROVHVHZXUZBMNP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|