C24H34N2O8P2 — CID 54522774
2-benzoyl-4,4-bis(diethoxyphosphoryl)-N-pyridin-3-ylbutanamide (PubChem CID 54522774) has the molecular formula C24H34N2O8P2 and a molecular weight of 540.49 g/mol. Its IUPAC name is 2-benzoyl-4,4-bis(diethoxyphosphoryl)-N-pyridin-3-ylbutanamide.
| Compound Name | 2-benzoyl-4,4-bis(diethoxyphosphoryl)-N-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 54522774 |
| Molecular Formula | C24H34N2O8P2 |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 2-benzoyl-4,4-bis(diethoxyphosphoryl)-N-pyridin-3-ylbutanamide |
| SMILES | CCOP(=O)(OCC)C(CC(C(=O)Nc1cccnc1)C(=O)c1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C24H34N2O8P2/c1-5-31-35(29,32-6-2)22(36(30,33-7-3)34-8-4)17-21(23(27)19-13-10-9-11-14-19)24(28)26-20-15-12-16-25-18-20/h9-16,18,21-22H,5-8,17H2,1-4H3,(H,26,28) |
| InChIKey | YQZVOYWVEHDWGH-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 130.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|