About (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide
(2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide (PubChem CID 2434239) has the molecular formula C24H23N3O3
and a molecular weight of 401.47 g/mol. Its IUPAC name is (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide.
Molecular Properties
| Compound Name | (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide |
| PubChem CID | 2434239 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide |
| SMILES | Cc1ccc(NC(=O)C[C@H](C(=O)Nc2cccnc2)C(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C24H23N3O3/c1-16-10-11-19(13-17(16)2)26-22(28)14-21(23(29)18-7-4-3-5-8-18)24(30)27-20-9-6-12-25-15-20/h3-13,15,21H,14H2,1-2H3,(H,26,28)(H,27,30)/t21-/m0/s1 |
| InChIKey | ZMEQTVFLEZRMHH-NRFANRHFSA-N |
| XLogP | 4.16 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide?
The IUPAC name of (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide (CID 2434239) is (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide.
What is the SMILES notation for (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide?
The canonical SMILES for (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide is Cc1ccc(NC(=O)C[C@H](C(=O)Nc2cccnc2)C(=O)c2ccccc2)cc1C.
What is the InChIKey of (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide?
The InChIKey is ZMEQTVFLEZRMHH-NRFANRHFSA-N. The full InChI is InChI=1S/C24H23N3O3/c1-16-10-11-19(13-17(16)2)26-22(28)14-21(23(29)18-7-4-3-5-8-18)24(30)27-20-9-6-12-25-15-20/h3-13,15,21H,14H2,1-2H3,(H,26,28)(H,27,30)/t21-/m0/s1.
What are the key properties of (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide?
(2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide has a molecular weight of 401.47 g/mol, XLogP of 4.16, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-benzoyl-N'-(3,4-dimethylphenyl)-N-pyridin-3-ylbutanediamide is sourced from PubChem (CID 2434239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).