C18H20N4O2 — CID 4039695
N-(3,4-dimethylphenyl)-N'-(pyridin-3-ylmethylideneamino)butanediamide (PubChem CID 4039695) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-N'-(pyridin-3-ylmethylideneamino)butanediamide.
| Compound Name | N-(3,4-dimethylphenyl)-N'-(pyridin-3-ylmethylideneamino)butanediamide |
|---|---|
| PubChem CID | 4039695 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-(3,4-dimethylphenyl)-N'-(pyridin-3-ylmethylideneamino)butanediamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)NN=Cc2cccnc2)cc1C |
| InChI | InChI=1S/C18H20N4O2/c1-13-5-6-16(10-14(13)2)21-17(23)7-8-18(24)22-20-12-15-4-3-9-19-11-15/h3-6,9-12H,7-8H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | JAGKHBWTBQJHOY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|