C17H18N6O2 — CID 4208581
N,N'-bis(pyridin-3-ylmethylideneamino)pentanediamide (PubChem CID 4208581) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is N,N'-bis(pyridin-3-ylmethylideneamino)pentanediamide.
| Compound Name | N,N'-bis(pyridin-3-ylmethylideneamino)pentanediamide |
|---|---|
| PubChem CID | 4208581 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N,N'-bis(pyridin-3-ylmethylideneamino)pentanediamide |
| SMILES | O=C(CCCC(=O)NN=Cc1cccnc1)NN=Cc1cccnc1 |
| InChI | InChI=1S/C17H18N6O2/c24-16(22-20-12-14-4-2-8-18-10-14)6-1-7-17(25)23-21-13-15-5-3-9-19-11-15/h2-5,8-13H,1,6-7H2,(H,22,24)(H,23,25) |
| InChIKey | MXMVTIRTHCFXIM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|