C16H15ClN4O2 — CID 4633351
N-(2-chlorophenyl)-N'-(pyridin-3-ylmethylideneamino)butanediamide (PubChem CID 4633351) has the molecular formula C16H15ClN4O2 and a molecular weight of 330.78 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-(pyridin-3-ylmethylideneamino)butanediamide.
| Compound Name | N-(2-chlorophenyl)-N'-(pyridin-3-ylmethylideneamino)butanediamide |
|---|---|
| PubChem CID | 4633351 |
| Molecular Formula | C16H15ClN4O2 |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-(2-chlorophenyl)-N'-(pyridin-3-ylmethylideneamino)butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccccc1Cl)NN=Cc1cccnc1 |
| InChI | InChI=1S/C16H15ClN4O2/c17-13-5-1-2-6-14(13)20-15(22)7-8-16(23)21-19-11-12-4-3-9-18-10-12/h1-6,9-11H,7-8H2,(H,20,22)(H,21,23) |
| InChIKey | AUSMRABAQRDXRE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|