C16H15ClN8OS — CID 17048544
2-[[4-amino-5-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chlorophenyl)acetamide (PubChem CID 17048544) has the molecular formula C16H15ClN8OS and a molecular weight of 402.87 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 17048544 |
| Molecular Formula | C16H15ClN8OS |
| Molecular Weight | 402.87 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-(pyridin-3-ylmethylidene)hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chlorophenyl)acetamide |
| SMILES | Nn1c(N/N=C/c2cccnc2)nnc1SCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C16H15ClN8OS/c17-12-5-1-2-6-13(12)21-14(26)10-27-16-24-23-15(25(16)18)22-20-9-11-4-3-7-19-8-11/h1-9H,10,18H2,(H,21,26)(H,22,23)/b20-9+ |
| InChIKey | JCDFOJLUMOKAEY-AWQFTUOYSA-N |
| XLogP | 2.22 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.87 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|