C18H17Cl2N7OS — CID 17074655
2-[[4-amino-5-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylphenyl)acetamide (PubChem CID 17074655) has the molecular formula C18H17Cl2N7OS and a molecular weight of 450.36 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 17074655 |
| Molecular Formula | C18H17Cl2N7OS |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)CSc1nnc(N/N=C/c2cccc(Cl)c2Cl)n1N |
| InChI | InChI=1S/C18H17Cl2N7OS/c1-11-5-2-3-8-14(11)23-15(28)10-29-18-26-25-17(27(18)21)24-22-9-12-6-4-7-13(19)16(12)20/h2-9H,10,21H2,1H3,(H,23,28)(H,24,25)/b22-9+ |
| InChIKey | UEVYYPSXMOVJPA-LSFURLLWSA-N |
| XLogP | 3.78 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|