C17H13Cl2F2N7OS — CID 17074712
2-[[4-amino-5-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-difluorophenyl)acetamide (PubChem CID 17074712) has the molecular formula C17H13Cl2F2N7OS and a molecular weight of 472.31 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 17074712 |
| Molecular Formula | C17H13Cl2F2N7OS |
| Molecular Weight | 472.31 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(2,3-dichlorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2,6-difluorophenyl)acetamide |
| SMILES | Nn1c(N/N=C/c2cccc(Cl)c2Cl)nnc1SCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C17H13Cl2F2N7OS/c18-10-4-1-3-9(14(10)19)7-23-25-16-26-27-17(28(16)22)30-8-13(29)24-15-11(20)5-2-6-12(15)21/h1-7H,8,22H2,(H,24,29)(H,25,26)/b23-7+ |
| InChIKey | VXOWPRRSEXOIHQ-HCGXMYGOSA-N |
| XLogP | 3.75 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|