C16H15FN8OS — CID 17049741
2-[[4-amino-5-[(2E)-2-[(2-fluorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-2-ylacetamide (PubChem CID 17049741) has the molecular formula C16H15FN8OS and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2E)-2-[(2-fluorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-2-ylacetamide.
| Compound Name | 2-[[4-amino-5-[(2E)-2-[(2-fluorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 17049741 |
| Molecular Formula | C16H15FN8OS |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-[[4-amino-5-[(2E)-2-[(2-fluorophenyl)methylidene]hydrazinyl]-1,2,4-triazol-3-yl]sulfanyl]-N-pyridin-2-ylacetamide |
| SMILES | Nn1c(N/N=C/c2ccccc2F)nnc1SCC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C16H15FN8OS/c17-12-6-2-1-5-11(12)9-20-22-15-23-24-16(25(15)18)27-10-14(26)21-13-7-3-4-8-19-13/h1-9H,10,18H2,(H,22,23)(H,19,21,26)/b20-9+ |
| InChIKey | PSZOMRGREIIGQI-AWQFTUOYSA-N |
| XLogP | 1.70 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|