C16H15BrN4O2 — CID 3988560
N-(4-bromophenyl)-N'-(pyridin-3-ylmethylideneamino)butanediamide (PubChem CID 3988560) has the molecular formula C16H15BrN4O2 and a molecular weight of 375.23 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-(pyridin-3-ylmethylideneamino)butanediamide.
| Compound Name | N-(4-bromophenyl)-N'-(pyridin-3-ylmethylideneamino)butanediamide |
|---|---|
| PubChem CID | 3988560 |
| Molecular Formula | C16H15BrN4O2 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | N-(4-bromophenyl)-N'-(pyridin-3-ylmethylideneamino)butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccc(Br)cc1)NN=Cc1cccnc1 |
| InChI | InChI=1S/C16H15BrN4O2/c17-13-3-5-14(6-4-13)20-15(22)7-8-16(23)21-19-11-12-2-1-9-18-10-12/h1-6,9-11H,7-8H2,(H,20,22)(H,21,23) |
| InChIKey | DPBYIDJYSSSNQN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|