C18H16Br3N3O3 — CID 136734104
N-(4-bromophenyl)-N'-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]pentanediamide (PubChem CID 136734104) has the molecular formula C18H16Br3N3O3 and a molecular weight of 562.06 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]pentanediamide.
| Compound Name | N-(4-bromophenyl)-N'-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]pentanediamide |
|---|---|
| PubChem CID | 136734104 |
| Molecular Formula | C18H16Br3N3O3 |
| Molecular Weight | 562.06 g/mol |
| Exact Mass | 558.87 |
| IUPAC Name | N-(4-bromophenyl)-N'-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]pentanediamide |
| SMILES | O=C(CCCC(=O)Nc1ccc(Br)cc1)N/N=C\c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C18H16Br3N3O3/c19-12-4-6-13(7-5-12)23-16(25)2-1-3-17(26)24-22-10-11-8-14(20)18(27)15(21)9-11/h4-10,27H,1-3H2,(H,23,25)(H,24,26)/b22-10- |
| InChIKey | SYDHBJUVACNSHH-YVNNLAQVSA-N |
| XLogP | 4.94 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.06 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|