C17H14Br2ClN3O3 — CID 136670499
N-(2-chlorophenyl)-N'-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]butanediamide (PubChem CID 136670499) has the molecular formula C17H14Br2ClN3O3 and a molecular weight of 503.58 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]butanediamide.
| Compound Name | N-(2-chlorophenyl)-N'-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 136670499 |
| Molecular Formula | C17H14Br2ClN3O3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 500.91 |
| IUPAC Name | N-(2-chlorophenyl)-N'-[(Z)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccccc1Cl)N/N=C\c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C17H14Br2ClN3O3/c18-11-7-10(8-12(19)17(11)26)9-21-23-16(25)6-5-15(24)22-14-4-2-1-3-13(14)20/h1-4,7-9,26H,5-6H2,(H,22,24)(H,23,25)/b21-9- |
| InChIKey | FAINUJZTXMBVGE-NKVSQWTQSA-N |
| XLogP | 4.44 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|