C25H23BrClN3O3 — CID 3933609
N'-[[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-(2-chlorophenyl)butanediamide (PubChem CID 3933609) has the molecular formula C25H23BrClN3O3 and a molecular weight of 528.83 g/mol. Its IUPAC name is N'-[[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-(2-chlorophenyl)butanediamide.
| Compound Name | N'-[[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-(2-chlorophenyl)butanediamide |
|---|---|
| PubChem CID | 3933609 |
| Molecular Formula | C25H23BrClN3O3 |
| Molecular Weight | 528.83 g/mol |
| Exact Mass | 527.06 |
| IUPAC Name | N'-[[3-bromo-4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]-N-(2-chlorophenyl)butanediamide |
| SMILES | Cc1ccc(COc2ccc(C=NNC(=O)CCC(=O)Nc3ccccc3Cl)cc2Br)cc1 |
| InChI | InChI=1S/C25H23BrClN3O3/c1-17-6-8-18(9-7-17)16-33-23-11-10-19(14-20(23)26)15-28-30-25(32)13-12-24(31)29-22-5-3-2-4-21(22)27/h2-11,14-15H,12-13,16H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | JARHOOMDGVHZQD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.83 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|