C17H14BrCl2N3O2 — CID 171980633
N-(2-bromophenyl)-N'-[(E)-(3,4-dichlorophenyl)methylideneamino]butanediamide (PubChem CID 171980633) has the molecular formula C17H14BrCl2N3O2 and a molecular weight of 443.13 g/mol. Its IUPAC name is N-(2-bromophenyl)-N'-[(E)-(3,4-dichlorophenyl)methylideneamino]butanediamide.
| Compound Name | N-(2-bromophenyl)-N'-[(E)-(3,4-dichlorophenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 171980633 |
| Molecular Formula | C17H14BrCl2N3O2 |
| Molecular Weight | 443.13 g/mol |
| Exact Mass | 440.96 |
| IUPAC Name | N-(2-bromophenyl)-N'-[(E)-(3,4-dichlorophenyl)methylideneamino]butanediamide |
| SMILES | O=C(CCC(=O)Nc1ccccc1Br)N/N=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H14BrCl2N3O2/c18-12-3-1-2-4-15(12)22-16(24)7-8-17(25)23-21-10-11-5-6-13(19)14(20)9-11/h1-6,9-10H,7-8H2,(H,22,24)(H,23,25)/b21-10+ |
| InChIKey | DYYCJQABTYEXDS-UFFVCSGVSA-N |
| XLogP | 4.62 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.13 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|