C19H20ClN3O2 — CID 5230931
N'-[(3-chlorophenyl)methylideneamino]-N-(3,4-dimethylphenyl)butanediamide (PubChem CID 5230931) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is N'-[(3-chlorophenyl)methylideneamino]-N-(3,4-dimethylphenyl)butanediamide.
| Compound Name | N'-[(3-chlorophenyl)methylideneamino]-N-(3,4-dimethylphenyl)butanediamide |
|---|---|
| PubChem CID | 5230931 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N'-[(3-chlorophenyl)methylideneamino]-N-(3,4-dimethylphenyl)butanediamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)NN=Cc2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C19H20ClN3O2/c1-13-6-7-17(10-14(13)2)22-18(24)8-9-19(25)23-21-12-15-4-3-5-16(20)11-15/h3-7,10-12H,8-9H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | LTNPJFTZSLZWCS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|