C17H29NO7P2 — CID 10454847
4,4-bis(diethoxyphosphoryl)-1-pyridin-3-ylbutan-1-one (PubChem CID 10454847) has the molecular formula C17H29NO7P2 and a molecular weight of 421.37 g/mol. Its IUPAC name is 4,4-bis(diethoxyphosphoryl)-1-pyridin-3-ylbutan-1-one.
| Compound Name | 4,4-bis(diethoxyphosphoryl)-1-pyridin-3-ylbutan-1-one |
|---|---|
| PubChem CID | 10454847 |
| Molecular Formula | C17H29NO7P2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 4,4-bis(diethoxyphosphoryl)-1-pyridin-3-ylbutan-1-one |
| SMILES | CCOP(=O)(OCC)C(CCC(=O)c1cccnc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C17H29NO7P2/c1-5-22-26(20,23-6-2)17(27(21,24-7-3)25-8-4)12-11-16(19)15-10-9-13-18-14-15/h9-10,13-14,17H,5-8,11-12H2,1-4H3 |
| InChIKey | RUPZTPGLZGWOON-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|