C15H22NO4P — CID 155931459
2-cyclopropyl-2-diethoxyphosphoryl-N-phenylacetamide (PubChem CID 155931459) has the molecular formula C15H22NO4P and a molecular weight of 311.32 g/mol. Its IUPAC name is 2-cyclopropyl-2-diethoxyphosphoryl-N-phenylacetamide.
| Compound Name | 2-cyclopropyl-2-diethoxyphosphoryl-N-phenylacetamide |
|---|---|
| PubChem CID | 155931459 |
| Molecular Formula | C15H22NO4P |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-cyclopropyl-2-diethoxyphosphoryl-N-phenylacetamide |
| SMILES | CCOP(=O)(OCC)C(C(=O)Nc1ccccc1)C1CC1 |
| InChI | InChI=1S/C15H22NO4P/c1-3-19-21(18,20-4-2)14(12-10-11-12)15(17)16-13-8-6-5-7-9-13/h5-9,12,14H,3-4,10-11H2,1-2H3,(H,16,17) |
| InChIKey | VFTFAIMHACLHJD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|