C15H23N2O6P — CID 4210354
ethyl 2-diethoxyphosphoryl-2-(phenylcarbamoylamino)acetate (PubChem CID 4210354) has the molecular formula C15H23N2O6P and a molecular weight of 358.33 g/mol. Its IUPAC name is ethyl 2-diethoxyphosphoryl-2-(phenylcarbamoylamino)acetate.
| Compound Name | ethyl 2-diethoxyphosphoryl-2-(phenylcarbamoylamino)acetate |
|---|---|
| PubChem CID | 4210354 |
| Molecular Formula | C15H23N2O6P |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | ethyl 2-diethoxyphosphoryl-2-(phenylcarbamoylamino)acetate |
| SMILES | CCOC(=O)C(NC(=O)Nc1ccccc1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H23N2O6P/c1-4-21-14(18)13(24(20,22-5-2)23-6-3)17-15(19)16-12-10-8-7-9-11-12/h7-11,13H,4-6H2,1-3H3,(H2,16,17,19) |
| InChIKey | ABTVFTSSKKBEGK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|