C21H29N2O4P — CID 2319972
1-[(R)-diethoxyphosphoryl(phenyl)methyl]-3-(2,4,6-trimethylphenyl)urea (PubChem CID 2319972) has the molecular formula C21H29N2O4P and a molecular weight of 404.45 g/mol. Its IUPAC name is 1-[(R)-diethoxyphosphoryl(phenyl)methyl]-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-[(R)-diethoxyphosphoryl(phenyl)methyl]-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 2319972 |
| Molecular Formula | C21H29N2O4P |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 1-[(R)-diethoxyphosphoryl(phenyl)methyl]-3-(2,4,6-trimethylphenyl)urea |
| SMILES | CCOP(=O)(OCC)[C@@H](NC(=O)Nc1c(C)cc(C)cc1C)c1ccccc1 |
| InChI | InChI=1S/C21H29N2O4P/c1-6-26-28(25,27-7-2)20(18-11-9-8-10-12-18)23-21(24)22-19-16(4)13-15(3)14-17(19)5/h8-14,20H,6-7H2,1-5H3,(H2,22,23,24)/t20-/m1/s1 |
| InChIKey | PZQKZUUIMGRCMY-HXUWFJFHSA-N |
| XLogP | 5.70 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|