C18H22ClN2O4P — CID 4037249
1-(3-chlorophenyl)-3-[diethoxyphosphoryl(phenyl)methyl]urea (PubChem CID 4037249) has the molecular formula C18H22ClN2O4P and a molecular weight of 396.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[diethoxyphosphoryl(phenyl)methyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[diethoxyphosphoryl(phenyl)methyl]urea |
|---|---|
| PubChem CID | 4037249 |
| Molecular Formula | C18H22ClN2O4P |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[diethoxyphosphoryl(phenyl)methyl]urea |
| SMILES | CCOP(=O)(OCC)C(NC(=O)Nc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C18H22ClN2O4P/c1-3-24-26(23,25-4-2)17(14-9-6-5-7-10-14)21-18(22)20-16-12-8-11-15(19)13-16/h5-13,17H,3-4H2,1-2H3,(H2,20,21,22) |
| InChIKey | VCDYPBQUWDRUNJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|