C18H21ClN2O2 — CID 74541947
1-(3-chlorophenyl)-3-[3-(1-phenylethoxy)propyl]urea (PubChem CID 74541947) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[3-(1-phenylethoxy)propyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[3-(1-phenylethoxy)propyl]urea |
|---|---|
| PubChem CID | 74541947 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[3-(1-phenylethoxy)propyl]urea |
| SMILES | CC(OCCCNC(=O)Nc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C18H21ClN2O2/c1-14(15-7-3-2-4-8-15)23-12-6-11-20-18(22)21-17-10-5-9-16(19)13-17/h2-5,7-10,13-14H,6,11-12H2,1H3,(H2,20,21,22) |
| InChIKey | ZCFYNDCLQQELCD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|