C21H24ClNO2 — CID 55567582
1-(3-chlorophenyl)-N-[3-(1-phenylethoxy)propyl]cyclopropane-1-carboxamide (PubChem CID 55567582) has the molecular formula C21H24ClNO2 and a molecular weight of 357.88 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[3-(1-phenylethoxy)propyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[3-(1-phenylethoxy)propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 55567582 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[3-(1-phenylethoxy)propyl]cyclopropane-1-carboxamide |
| SMILES | CC(OCCCNC(=O)C1(c2cccc(Cl)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H24ClNO2/c1-16(17-7-3-2-4-8-17)25-14-6-13-23-20(24)21(11-12-21)18-9-5-10-19(22)15-18/h2-5,7-10,15-16H,6,11-14H2,1H3,(H,23,24) |
| InChIKey | BMUYMLQNDWJEJK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|