C14H21ClNO4P — CID 15495992
2-chloro-N-[diethoxyphosphoryl(phenyl)methyl]propanamide (PubChem CID 15495992) has the molecular formula C14H21ClNO4P and a molecular weight of 333.75 g/mol. Its IUPAC name is 2-chloro-N-[diethoxyphosphoryl(phenyl)methyl]propanamide.
| Compound Name | 2-chloro-N-[diethoxyphosphoryl(phenyl)methyl]propanamide |
|---|---|
| PubChem CID | 15495992 |
| Molecular Formula | C14H21ClNO4P |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-chloro-N-[diethoxyphosphoryl(phenyl)methyl]propanamide |
| SMILES | CCOP(=O)(OCC)C(NC(=O)C(C)Cl)c1ccccc1 |
| InChI | InChI=1S/C14H21ClNO4P/c1-4-19-21(18,20-5-2)14(16-13(17)11(3)15)12-9-7-6-8-10-12/h6-11,14H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | LKPXLQCNPLZPSD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|