C19H23NO — CID 793462
(2S)-2-methyl-3-phenyl-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 793462) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is (2S)-2-methyl-3-phenyl-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | (2S)-2-methyl-3-phenyl-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 793462 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (2S)-2-methyl-3-phenyl-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1cc(C)c(NC(=O)[C@@H](C)Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H23NO/c1-13-10-14(2)18(15(3)11-13)20-19(21)16(4)12-17-8-6-5-7-9-17/h5-11,16H,12H2,1-4H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | NLBJODFZGCFLBL-INIZCTEOSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |