C18H22N2O — CID 78666778
2-anilino-N-(2,4,6-trimethylphenyl)propanamide (PubChem CID 78666778) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-anilino-N-(2,4,6-trimethylphenyl)propanamide.
| Compound Name | 2-anilino-N-(2,4,6-trimethylphenyl)propanamide |
|---|---|
| PubChem CID | 78666778 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-anilino-N-(2,4,6-trimethylphenyl)propanamide |
| SMILES | Cc1cc(C)c(NC(=O)C(C)Nc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C18H22N2O/c1-12-10-13(2)17(14(3)11-12)20-18(21)15(4)19-16-8-6-5-7-9-16/h5-11,15,19H,1-4H3,(H,20,21) |
| InChIKey | YZPPZXXUXNYXLY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |