C22H29ClN3O7PS — CID 98389452
1-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-[(R)-diethoxyphosphoryl(phenyl)methyl]urea (PubChem CID 98389452) has the molecular formula C22H29ClN3O7PS and a molecular weight of 545.98 g/mol. Its IUPAC name is 1-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-[(R)-diethoxyphosphoryl(phenyl)methyl]urea.
| Compound Name | 1-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-[(R)-diethoxyphosphoryl(phenyl)methyl]urea |
|---|---|
| PubChem CID | 98389452 |
| Molecular Formula | C22H29ClN3O7PS |
| Molecular Weight | 545.98 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 1-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-3-[(R)-diethoxyphosphoryl(phenyl)methyl]urea |
| SMILES | CCOP(=O)(OCC)[C@@H](NC(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H29ClN3O7PS/c1-3-32-34(28,33-4-2)21(17-8-6-5-7-9-17)25-22(27)24-18-10-11-19(23)20(16-18)35(29,30)26-12-14-31-15-13-26/h5-11,16,21H,3-4,12-15H2,1-2H3,(H2,24,25,27)/t21-/m1/s1 |
| InChIKey | NCUGMBLOAFPZPP-OAQYLSRUSA-N |
| XLogP | 4.45 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.98 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|