C15H22ClN3O3S2 — CID 8668652
1-butyl-3-(4-chloro-3-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 8668652) has the molecular formula C15H22ClN3O3S2 and a molecular weight of 391.95 g/mol. Its IUPAC name is 1-butyl-3-(4-chloro-3-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-butyl-3-(4-chloro-3-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 8668652 |
| Molecular Formula | C15H22ClN3O3S2 |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1-butyl-3-(4-chloro-3-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | CCCCNC(=S)Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H22ClN3O3S2/c1-2-3-6-17-15(23)18-12-4-5-13(16)14(11-12)24(20,21)19-7-9-22-10-8-19/h4-5,11H,2-3,6-10H2,1H3,(H2,17,18,23) |
| InChIKey | IUPSFLKBWVZXPU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|