C13H21O5P — CID 23420875
(1R,2S)-1-diethoxyphosphoryl-2-(3-methylphenyl)ethane-1,2-diol (PubChem CID 23420875) has the molecular formula C13H21O5P and a molecular weight of 288.28 g/mol. Its IUPAC name is (1R,2S)-1-diethoxyphosphoryl-2-(3-methylphenyl)ethane-1,2-diol.
| Compound Name | (1R,2S)-1-diethoxyphosphoryl-2-(3-methylphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 23420875 |
| Molecular Formula | C13H21O5P |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (1R,2S)-1-diethoxyphosphoryl-2-(3-methylphenyl)ethane-1,2-diol |
| SMILES | CCOP(=O)(OCC)[C@@H](O)[C@@H](O)c1cccc(C)c1 |
| InChI | InChI=1S/C13H21O5P/c1-4-17-19(16,18-5-2)13(15)12(14)11-8-6-7-10(3)9-11/h6-9,12-15H,4-5H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | HZIMMOGTJAZBEW-QWHCGFSZSA-N |
| XLogP | 2.61 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|