C10H14O2 — CID 134966873
(1R,2R)-1-(3-methylphenyl)propane-1,2-diol (PubChem CID 134966873) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1R,2R)-1-(3-methylphenyl)propane-1,2-diol.
| Compound Name | (1R,2R)-1-(3-methylphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 134966873 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1R,2R)-1-(3-methylphenyl)propane-1,2-diol |
| SMILES | Cc1cccc([C@@H](O)[C@@H](C)O)c1 |
| InChI | InChI=1S/C10H14O2/c1-7-4-3-5-9(6-7)10(12)8(2)11/h3-6,8,10-12H,1-2H3/t8-,10+/m1/s1 |
| InChIKey | OMSYFRNPYYXGBD-SCZZXKLOSA-N |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |