C11H17NO — CID 65187843
4-amino-3-(3-methylphenyl)butan-2-ol (PubChem CID 65187843) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-amino-3-(3-methylphenyl)butan-2-ol.
| Compound Name | 4-amino-3-(3-methylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 65187843 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-amino-3-(3-methylphenyl)butan-2-ol |
| SMILES | Cc1cccc(C(CN)C(C)O)c1 |
| InChI | InChI=1S/C11H17NO/c1-8-4-3-5-10(6-8)11(7-12)9(2)13/h3-6,9,11,13H,7,12H2,1-2H3 |
| InChIKey | JRSHADAMZBSVES-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |