C12H19N2O4P — CID 2301679
1-(diethoxyphosphorylmethyl)-3-phenylurea (PubChem CID 2301679) has the molecular formula C12H19N2O4P and a molecular weight of 286.27 g/mol. Its IUPAC name is 1-(diethoxyphosphorylmethyl)-3-phenylurea.
| Compound Name | 1-(diethoxyphosphorylmethyl)-3-phenylurea |
|---|---|
| PubChem CID | 2301679 |
| Molecular Formula | C12H19N2O4P |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-(diethoxyphosphorylmethyl)-3-phenylurea |
| SMILES | CCOP(=O)(CNC(=O)Nc1ccccc1)OCC |
| InChI | InChI=1S/C12H19N2O4P/c1-3-17-19(16,18-4-2)10-13-12(15)14-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H2,13,14,15) |
| InChIKey | YLFXFNDFCRJGLB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|