C15H23N2O6P — CID 15458754
benzyl N-[2-(diethoxyphosphorylmethylamino)-2-oxoethyl]carbamate (PubChem CID 15458754) has the molecular formula C15H23N2O6P and a molecular weight of 358.33 g/mol. Its IUPAC name is benzyl N-[2-(diethoxyphosphorylmethylamino)-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-(diethoxyphosphorylmethylamino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 15458754 |
| Molecular Formula | C15H23N2O6P |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | benzyl N-[2-(diethoxyphosphorylmethylamino)-2-oxoethyl]carbamate |
| SMILES | CCOP(=O)(CNC(=O)CNC(=O)OCc1ccccc1)OCC |
| InChI | InChI=1S/C15H23N2O6P/c1-3-22-24(20,23-4-2)12-17-14(18)10-16-15(19)21-11-13-8-6-5-7-9-13/h5-9H,3-4,10-12H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | AFMRVMXZAUBIDW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|