C20H27N2O4P — CID 3503064
1-[4-(diethoxyphosphorylmethyl)phenyl]-3-[(4-methylphenyl)methyl]urea (PubChem CID 3503064) has the molecular formula C20H27N2O4P and a molecular weight of 390.42 g/mol. Its IUPAC name is 1-[4-(diethoxyphosphorylmethyl)phenyl]-3-[(4-methylphenyl)methyl]urea.
| Compound Name | 1-[4-(diethoxyphosphorylmethyl)phenyl]-3-[(4-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 3503064 |
| Molecular Formula | C20H27N2O4P |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[4-(diethoxyphosphorylmethyl)phenyl]-3-[(4-methylphenyl)methyl]urea |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)NCc2ccc(C)cc2)cc1)OCC |
| InChI | InChI=1S/C20H27N2O4P/c1-4-25-27(24,26-5-2)15-18-10-12-19(13-11-18)22-20(23)21-14-17-8-6-16(3)7-9-17/h6-13H,4-5,14-15H2,1-3H3,(H2,21,22,23) |
| InChIKey | SNBYOZCAYUQGEO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|