C14H22NO5P — CID 130408458
[4-(diethoxyphosphorylmethyl)phenyl] N-ethylcarbamate (PubChem CID 130408458) has the molecular formula C14H22NO5P and a molecular weight of 315.31 g/mol. Its IUPAC name is [4-(diethoxyphosphorylmethyl)phenyl] N-ethylcarbamate.
| Compound Name | [4-(diethoxyphosphorylmethyl)phenyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 130408458 |
| Molecular Formula | C14H22NO5P |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | [4-(diethoxyphosphorylmethyl)phenyl] N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1ccc(CP(=O)(OCC)OCC)cc1 |
| InChI | InChI=1S/C14H22NO5P/c1-4-15-14(16)20-13-9-7-12(8-10-13)11-21(17,18-5-2)19-6-3/h7-10H,4-6,11H2,1-3H3,(H,15,16) |
| InChIKey | LUUANJUUIAIGKM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|