About [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate
[4-(ethylcarbamoyl)phenyl] N-fluorocarbamate (PubChem CID 59335547) has the molecular formula C10H11FN2O3
and a molecular weight of 226.21 g/mol. Its IUPAC name is [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate.
Molecular Properties
| Compound Name | [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate |
| PubChem CID | 59335547 |
| Molecular Formula | C10H11FN2O3 |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate |
| SMILES | CCNC(=O)c1ccc(OC(=O)NF)cc1 |
| InChI | InChI=1S/C10H11FN2O3/c1-2-12-9(14)7-3-5-8(6-4-7)16-10(15)13-11/h3-6H,2H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | HFSWSBABYGNDOX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate?
The IUPAC name of [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate (CID 59335547) is [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate.
What is the SMILES notation for [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate?
The canonical SMILES for [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate is CCNC(=O)c1ccc(OC(=O)NF)cc1.
What is the InChIKey of [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate?
The InChIKey is HFSWSBABYGNDOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O3/c1-2-12-9(14)7-3-5-8(6-4-7)16-10(15)13-11/h3-6H,2H2,1H3,(H,12,14)(H,13,15).
What are the key properties of [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate?
[4-(ethylcarbamoyl)phenyl] N-fluorocarbamate has a molecular weight of 226.21 g/mol, XLogP of 1.41, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(ethylcarbamoyl)phenyl] N-fluorocarbamate is sourced from PubChem (CID 59335547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).