C13H22ClN2O4P — CID 87467855
2-amino-N-[4-(diethoxyphosphorylmethyl)phenyl]acetamide;hydrochloride (PubChem CID 87467855) has the molecular formula C13H22ClN2O4P and a molecular weight of 336.76 g/mol. Its IUPAC name is 2-amino-N-[4-(diethoxyphosphorylmethyl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-amino-N-[4-(diethoxyphosphorylmethyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 87467855 |
| Molecular Formula | C13H22ClN2O4P |
| Molecular Weight | 336.76 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-amino-N-[4-(diethoxyphosphorylmethyl)phenyl]acetamide;hydrochloride |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CN)cc1)OCC.Cl |
| InChI | InChI=1S/C13H21N2O4P.ClH/c1-3-18-20(17,19-4-2)10-11-5-7-12(8-6-11)15-13(16)9-14;/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,16);1H |
| InChIKey | VMVFRPFCINWJJJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.76 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|