C21H25N2O6P — CID 3868557
N-[4-(diethoxyphosphorylmethyl)phenyl]-3-(2-oxo-1,3-benzoxazol-3-yl)propanamide (PubChem CID 3868557) has the molecular formula C21H25N2O6P and a molecular weight of 432.41 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)phenyl]-3-(2-oxo-1,3-benzoxazol-3-yl)propanamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-(2-oxo-1,3-benzoxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 3868557 |
| Molecular Formula | C21H25N2O6P |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-(2-oxo-1,3-benzoxazol-3-yl)propanamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CCn2c(=O)oc3ccccc32)cc1)OCC |
| InChI | InChI=1S/C21H25N2O6P/c1-3-27-30(26,28-4-2)15-16-9-11-17(12-10-16)22-20(24)13-14-23-18-7-5-6-8-19(18)29-21(23)25/h5-12H,3-4,13-15H2,1-2H3,(H,22,24) |
| InChIKey | NRONFYGCPZURJJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|